CAS 1260882-93-6 is the registry number for 3,5-Difluoro-4-nitrobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3,5-difluoro-4-nitrobenzamide (CAS 1260882-93-6) is a chemical compound with the molecular formula C7H4F2N2O3 and a molecular weight of 202.11 g/mol. IUPAC name: 3,5-difluoro-4-nitrobenzamide. InChIKey: UWRANGRDPHQGBQ-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2O3 |
|---|---|
| Molecular weight | 202.11 g/mol |
| IUPAC name | 3,5-difluoro-4-nitrobenzamide |
| InChIKey | UWRANGRDPHQGBQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)[N+](=O)[O-])F)C(=O)N |
Computed by PubChem (NCBI)