CAS 1806388-74-8 appears in our catalog under these names: 2,3-Difluoro-5-nitrobenzamide, 95%, 2,3–Difluoro–5–nitrobenzamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
2,3-difluoro-5-nitrobenzamide (CAS 1806388-74-8) is a chemical compound with the molecular formula C7H4F2N2O3 and a molecular weight of 202.11 g/mol. IUPAC name: 2,3-difluoro-5-nitrobenzamide. InChIKey: DIAZKPONYLLKQD-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2O3 |
|---|---|
| Molecular weight | 202.11 g/mol |
| IUPAC name | 2,3-difluoro-5-nitrobenzamide |
| InChIKey | DIAZKPONYLLKQD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)N)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)