Products 1260902-01-9

CAS 1260902-01-9 is the registry number for 4-(difluoromethyl)-2-hydroxy-pyrimidine-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg.

Structural formula: {0} (CAS {1})

6-(difluoromethyl)-2-oxo-1H-pyrimidine-5-carboxylic acid (CAS 1260902-01-9) is a chemical compound with the molecular formula C6H4F2N2O3 and a molecular weight of 190.10 g/mol. IUPAC name: 6-(difluoromethyl)-2-oxo-1H-pyrimidine-5-carboxylic acid. InChIKey: MGSVVLOYKLDYKS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F2N2O3
Molecular weight190.10 g/mol
IUPAC name6-(difluoromethyl)-2-oxo-1H-pyrimidine-5-carboxylic acid
InChIKeyMGSVVLOYKLDYKS-UHFFFAOYSA-N
SMILESC1=NC(=O)NC(=C1C(=O)O)C(F)F

Computed by PubChem (NCBI)