Products 1818341-48-8

CAS 1818341-48-8 is the registry number for 5-(Difluoromethoxy)pyrimidine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

5-(difluoromethoxy)pyrimidine-2-carboxylic acid (CAS 1818341-48-8) is a chemical compound with the molecular formula C6H4F2N2O3 and a molecular weight of 190.10 g/mol. IUPAC name: 5-(difluoromethoxy)pyrimidine-2-carboxylic acid. InChIKey: SMTCCDPQBGRJQD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4F2N2O3
Molecular weight190.10 g/mol
IUPAC name5-(difluoromethoxy)pyrimidine-2-carboxylic acid
InChIKeySMTCCDPQBGRJQD-UHFFFAOYSA-N
SMILESC1=C(C=NC(=N1)C(=O)O)OC(F)F

Computed by PubChem (NCBI)