CAS 1260986-99-9 is the registry number for Ethyl 3-[(4-isopropylpiperazin-1-yl)sulfonyl]-1h-pyrazole-4-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 5-(4-propan-2-ylpiperazin-1-yl)sulfonyl-1H-pyrazole-4-carboxylate (CAS 1260986-99-9) is a chemical compound with the molecular formula C13H22N4O4S and a molecular weight of 330.41 g/mol. IUPAC name: ethyl 5-(4-propan-2-ylpiperazin-1-yl)sulfonyl-1H-pyrazole-4-carboxylate. InChIKey: DDJYEJFTPIOETM-UHFFFAOYSA-N.
| Molecular formula | C13H22N4O4S |
|---|---|
| Molecular weight | 330.41 g/mol |
| IUPAC name | ethyl 5-(4-propan-2-ylpiperazin-1-yl)sulfonyl-1H-pyrazole-4-carboxylate |
| InChIKey | DDJYEJFTPIOETM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NN=C1)S(=O)(=O)N2CCN(CC2)C(C)C |
Computed by PubChem (NCBI)