CAS 73857-20-2 appears in our catalog under these names: N-(2-(((5-((Dimethyloxidoamino)-methyl)furan-2-yl)methyl)sulphanyl)ethyl)-N'-methyl-2-nitroethene-1,1-diamine (Ranitidine N-Oxide), Ranitidine EP Impurity E (Ranitidine N-Oxide), Ranitidine EP Impurity E,Ranitidine N-oxide, Ranitidine Impurity 5(Ranitidine EP Impurity E), Ranitidine N-Oxide, >95% (HPLC). Offered by: Mikromol, Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 200mg, 1mg.
N,N-dimethyl-1-[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methanamine oxide (CAS 73857-20-2) is a chemical compound with the molecular formula C13H22N4O4S and a molecular weight of 330.41 g/mol. IUPAC name: N,N-dimethyl-1-[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methanamine oxide. InChIKey: DFJVUWAHTQPQCV-UHFFFAOYSA-N.
| Molecular formula | C13H22N4O4S |
|---|---|
| Molecular weight | 330.41 g/mol |
| IUPAC name | N,N-dimethyl-1-[5-[2-[[1-(methylamino)-2-nitroethenyl]amino]ethylsulfanylmethyl]furan-2-yl]methanamine oxide |
| InChIKey | DFJVUWAHTQPQCV-UHFFFAOYSA-N |
| SMILES | CNC(=C[N+](=O)[O-])NCCSCC1=CC=C(O1)C[N+](C)(C)[O-] |
Computed by PubChem (NCBI)