CAS 1261170-75-5 appears in our catalog under these names: Aldicarb-(N-methyl-13C,d3 carbamoyl-13C), ALDICARB-(N-METHYL-13C,D3 CARBAMOYL-13C&, 13C2,D3-Aldicarb, 13C2,D3-Aldicarb, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: 10mg, 5MG, 1MG, 25MG, 1x5mg, 1x1ml.
[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate (CAS 1261170-75-5) is a chemical compound with the molecular formula C7H14N2O2S and a molecular weight of 195.27 g/mol. IUPAC name: [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate. InChIKey: QGLZXHRNAYXIBU-FONWFMSDSA-N.
| Molecular formula | C7H14N2O2S |
|---|---|
| Molecular weight | 195.27 g/mol |
| IUPAC name | [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-(trideuterio(113C)methyl)carbamate |
| InChIKey | QGLZXHRNAYXIBU-FONWFMSDSA-N |
| SMILES | [2H][13C]([2H])([2H])N[13C](=O)O/N=C/C(C)(C)SC |
Computed by PubChem (NCBI)