Products 1795142-83-4
CAS 1795142-83-4 appears in our catalog under these names: Aldicarb-d3, Aldicarb D3, Aldicarb–d3. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
[(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-(trideuteriomethyl)carbamate (CAS 1795142-83-4) is a chemical compound with the molecular formula C7H14N2O2S and a molecular weight of 193.28 g/mol. IUPAC name: [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-(trideuteriomethyl)carbamate. InChIKey: QGLZXHRNAYXIBU-UYUKVFNDSA-N.
| Molecular formula | C7H14N2O2S |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | [(E)-(2-methyl-2-methylsulfanylpropylidene)amino] N-(trideuteriomethyl)carbamate |
| InChIKey | QGLZXHRNAYXIBU-UYUKVFNDSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)O/N=C/C(C)(C)SC |
Computed by PubChem (NCBI)