CAS 1261170-86-8 appears in our catalog under these names: 2–Chloroaniline hydrochloride–13C6, 2-Chloroaniline hydrochloride-13C6, 99.64%, 99.64%, 2-Chloroaniline hydrochloride-13C6, 99.64%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10 mg, 25 mg, 5 mg.
6-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine;hydrochloride (CAS 1261170-86-8) is a chemical compound with the molecular formula C6H7Cl2N and a molecular weight of 169.99 g/mol. IUPAC name: 6-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine;hydrochloride. InChIKey: DRGIDRZFKRLQTE-BVNCJLROSA-N.
| Molecular formula | C6H7Cl2N |
|---|---|
| Molecular weight | 169.99 g/mol |
| IUPAC name | 6-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine;hydrochloride |
| InChIKey | DRGIDRZFKRLQTE-BVNCJLROSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13C](=[13CH]1)N)Cl.Cl |
Computed by PubChem (NCBI)