CAS 1261222-08-5 is the registry number for 4-(3,4-Diaminophenyl)morpholin-3-one. Offered by: TRC. Available pack sizes: 100mg.
4-(3,4-diaminophenyl)morpholin-3-one (CAS 1261222-08-5) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 4-(3,4-diaminophenyl)morpholin-3-one. InChIKey: ADIGYOVKNNNFKB-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 4-(3,4-diaminophenyl)morpholin-3-one |
| InChIKey | ADIGYOVKNNNFKB-UHFFFAOYSA-N |
| SMILES | C1COCC(=O)N1C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)