Products 1261234-68-7
CAS 1261234-68-7 is the registry number for tert-Butyl 4-(2-chloro-6-methylpyrimidin-4-yl)piperazine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 100mg.
Tert-butyl 4-(2-chloro-6-methylpyrimidin-4-yl)piperazine-1-carboxylate (CAS 1261234-68-7) is a chemical compound with the molecular formula C14H21ClN4O2 and a molecular weight of 312.79 g/mol. IUPAC name: tert-butyl 4-(2-chloro-6-methylpyrimidin-4-yl)piperazine-1-carboxylate. InChIKey: DVSPFHLEILQZFS-UHFFFAOYSA-N.
| Molecular formula | C14H21ClN4O2 |
|---|---|
| Molecular weight | 312.79 g/mol |
| IUPAC name | tert-butyl 4-(2-chloro-6-methylpyrimidin-4-yl)piperazine-1-carboxylate |
| InChIKey | DVSPFHLEILQZFS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)Cl)N2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)