CAS 313657-13-5 is the registry number for (R)–tert–butyl 4–(3–chloropyrazin–2–yl)–3–methylpiperazine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl (3R)-4-(3-chloropyrazin-2-yl)-3-methylpiperazine-1-carboxylate (CAS 313657-13-5) is a chemical compound with the molecular formula C14H21ClN4O2 and a molecular weight of 312.79 g/mol. IUPAC name: tert-butyl (3R)-4-(3-chloropyrazin-2-yl)-3-methylpiperazine-1-carboxylate. InChIKey: DLDJZGBZANJUQH-SNVBAGLBSA-N.
| Molecular formula | C14H21ClN4O2 |
|---|---|
| Molecular weight | 312.79 g/mol |
| IUPAC name | tert-butyl (3R)-4-(3-chloropyrazin-2-yl)-3-methylpiperazine-1-carboxylate |
| InChIKey | DLDJZGBZANJUQH-SNVBAGLBSA-N |
| SMILES | C[C@@H]1CN(CCN1C2=NC=CN=C2Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)