Products 1261365-74-5
CAS 1261365-74-5 is the registry number for 2-Methyl-6-(trifluoromethyl)-1,8-naphthyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-6-(trifluoromethyl)-1,8-naphthyridine (CAS 1261365-74-5) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 2-methyl-6-(trifluoromethyl)-1,8-naphthyridine. InChIKey: ATPHVXQFNQZKBB-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 2-methyl-6-(trifluoromethyl)-1,8-naphthyridine |
| InChIKey | ATPHVXQFNQZKBB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC=C(C=C2C=C1)C(F)(F)F |
Computed by PubChem (NCBI)