CAS 1261365-91-6 is the registry number for (Rac)-trans-1-tert-butyl 3-methyl 4-(1,5-naphthyridin-3-yl)pyrrolidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-O-tert-butyl 3-O-methyl (3S,4R)-4-(1,5-naphthyridin-3-yl)pyrrolidine-1,3-dicarboxylate (CAS 1261365-91-6) is a chemical compound with the molecular formula C19H23N3O4 and a molecular weight of 357.4 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,4R)-4-(1,5-naphthyridin-3-yl)pyrrolidine-1,3-dicarboxylate. InChIKey: UOFSYRFWXPOPPR-UONOGXRCSA-N.
| Molecular formula | C19H23N3O4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,4R)-4-(1,5-naphthyridin-3-yl)pyrrolidine-1,3-dicarboxylate |
| InChIKey | UOFSYRFWXPOPPR-UONOGXRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(=O)OC)C2=CC3=C(C=CC=N3)N=C2 |
Computed by PubChem (NCBI)