CAS 2650530-01-9 is the registry number for PFI-6N. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-cyclopentyl-5-[4-(dimethylcarbamoyl)-3-hydroxyphenyl]-N-methyl-1,2-oxazole-3-carboxamide (CAS 2650530-01-9) is a chemical compound with the molecular formula C19H23N3O4 and a molecular weight of 357.4 g/mol. IUPAC name: N-cyclopentyl-5-[4-(dimethylcarbamoyl)-3-hydroxyphenyl]-N-methyl-1,2-oxazole-3-carboxamide. InChIKey: CKEICVFLYGXFOP-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-cyclopentyl-5-[4-(dimethylcarbamoyl)-3-hydroxyphenyl]-N-methyl-1,2-oxazole-3-carboxamide |
| InChIKey | CKEICVFLYGXFOP-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)C2=CC(=NO2)C(=O)N(C)C3CCCC3)O |
Computed by PubChem (NCBI)