CAS 1240250-49-0 is the registry number for D-Ala-D-betaNal-Ala-OH. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]propanoic acid (CAS 1240250-49-0) is a chemical compound with the molecular formula C19H23N3O4 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]propanoic acid. InChIKey: AFLOMGLVDWDWMI-BFQNTYOBSA-N.
| Molecular formula | C19H23N3O4 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-[[(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-naphthalen-2-ylpropanoyl]amino]propanoic acid |
| InChIKey | AFLOMGLVDWDWMI-BFQNTYOBSA-N |
| SMILES | C[C@H](C(=O)N[C@H](CC1=CC2=CC=CC=C2C=C1)C(=O)N[C@@H](C)C(=O)O)N |
Computed by PubChem (NCBI)