CAS 1261393-73-0 appears in our catalog under these names: Diclofenac-13C6 Sodium Salt, DICLOFENAC-(ACETOPHENYL RING-<H/13>C<I/6, Diclofenac-13C6 (sodium), 99.96%, 13C6-Diclofenac sodium, Concentration: 100 µg/ml Solvent: Methanol, 13C6-Diclofenac sodium . Offered by: Chemat Brand, Sigma-Aldrich, MedChemExpress, HPC Standards. Available pack sizes: on request, 10MG, 10 mg, 1x1ml, 1x10mg.
Sodium 2-[6-(2,6-dichloroanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetate (CAS 1261393-73-0) is a chemical compound with the molecular formula C14H10Cl2NNaO2 and a molecular weight of 324.08 g/mol. IUPAC name: sodium 2-[6-(2,6-dichloroanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetate. InChIKey: KPHWPUGNDIVLNH-OYZQBFNVSA-M.
| Molecular formula | C14H10Cl2NNaO2 |
|---|---|
| Molecular weight | 324.08 g/mol |
| IUPAC name | sodium 2-[6-(2,6-dichloroanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetate |
| InChIKey | KPHWPUGNDIVLNH-OYZQBFNVSA-M |
| SMILES | C1=CC(=C(C(=C1)Cl)N[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2CC(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)