CAS 154523-54-3 appears in our catalog under these names: Diclofenac-d4 Sodium Salt (Phenyl-d4-acetic), Diclofenac-d4 Sodium Salt (phenyl-d4-acetic), 98 atom % D, min 98% Chemical Purity, Diclofenac–d4 sodium, Diclofenac-d4 (sodium), 99.49%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 0,005g, 1 mg, 5 mg.
Sodium 2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetate (CAS 154523-54-3) is a chemical compound with the molecular formula C14H10Cl2NNaO2 and a molecular weight of 322.2 g/mol. IUPAC name: sodium 2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetate. InChIKey: KPHWPUGNDIVLNH-QOJBZNDNSA-M.
| Molecular formula | C14H10Cl2NNaO2 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | sodium 2-[2,3,4,5-tetradeuterio-6-(2,6-dichloroanilino)phenyl]acetate |
| InChIKey | KPHWPUGNDIVLNH-QOJBZNDNSA-M |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl)[2H])[2H].[Na+] |
Computed by PubChem (NCBI)