CAS 1261395-92-9 is the registry number for (+)-N-Desmethyl Tramadol-d3. Offered by: TRC. Available pack sizes: 25mg.
Cis-(1R,2R)-1-(3-methoxyphenyl)-2-[(trideuteriomethylamino)methyl]cyclohexan-1-ol (CAS 1261395-92-9) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 252.37 g/mol. IUPAC name: cis-(1R,2R)-1-(3-methoxyphenyl)-2-[(trideuteriomethylamino)methyl]cyclohexan-1-ol. InChIKey: VUMQHLSPUAFKKK-RSGFOGQCSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 252.37 g/mol |
| IUPAC name | cis-(1R,2R)-1-(3-methoxyphenyl)-2-[(trideuteriomethylamino)methyl]cyclohexan-1-ol |
| InChIKey | VUMQHLSPUAFKKK-RSGFOGQCSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)OC)O |
Computed by PubChem (NCBI)