CAS 75377-45-6 is the registry number for rac N-Desmethyl Tramadol. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
Cis-(1R,2R)-1-(3-methoxyphenyl)-2-(methylaminomethyl)cyclohexan-1-ol (CAS 75377-45-6) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. IUPAC name: cis-(1R,2R)-1-(3-methoxyphenyl)-2-(methylaminomethyl)cyclohexan-1-ol. InChIKey: VUMQHLSPUAFKKK-HIFRSBDPSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | cis-(1R,2R)-1-(3-methoxyphenyl)-2-(methylaminomethyl)cyclohexan-1-ol |
| InChIKey | VUMQHLSPUAFKKK-HIFRSBDPSA-N |
| SMILES | CNC[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)OC)O |
Computed by PubChem (NCBI)