CAS 1261396-36-4 appears in our catalog under these names: (13C6)-1-Hydroxymidazolam, 1’-Hydroxy Midazolam-13C6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
[8-chloro-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-1-yl]methanol (CAS 1261396-36-4) is a chemical compound with the molecular formula C18H13ClFN3O and a molecular weight of 347.72 g/mol. IUPAC name: [8-chloro-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-1-yl]methanol. InChIKey: QHSMEGADRFZVNE-GLCRKPPFSA-N.
| Molecular formula | C18H13ClFN3O |
|---|---|
| Molecular weight | 347.72 g/mol |
| IUPAC name | [8-chloro-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepin-1-yl]methanol |
| InChIKey | QHSMEGADRFZVNE-GLCRKPPFSA-N |
| SMILES | C1C2=CN=C(N2[13C]3=[13C]([13CH]=[13C]([13CH]=[13CH]3)Cl)C(=N1)C4=CC=CC=C4F)CO |
Computed by PubChem (NCBI)