CAS 59468-86-9 appears in our catalog under these names: Midazolam 2-Oxide, >95% (HPLC), Midazolam 2-Oxide (1mg/ml in Acetonitrile), Midazolam 2-oxide. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 1x1ml, 2mg, 25mg.
8-chloro-6-(2-fluorophenyl)-1-methyl-2-oxido-4H-imidazo[1,5-a][1,4]benzodiazepin-2-ium (CAS 59468-86-9) is a chemical compound with the molecular formula C18H13ClFN3O and a molecular weight of 341.8 g/mol. IUPAC name: 8-chloro-6-(2-fluorophenyl)-1-methyl-2-oxido-4H-imidazo[1,5-a][1,4]benzodiazepin-2-ium. InChIKey: QVPQNEQZMOGERL-UHFFFAOYSA-N.
| Molecular formula | C18H13ClFN3O |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | 8-chloro-6-(2-fluorophenyl)-1-methyl-2-oxido-4H-imidazo[1,5-a][1,4]benzodiazepin-2-ium |
| InChIKey | QVPQNEQZMOGERL-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4F)[O-] |
Computed by PubChem (NCBI)