CAS 1261398-22-4 appears in our catalog under these names: rac N,O-Didesmethyl Tramadol-d3, >95% (HPLC), rac N,o-Didesmethyl tramadol-d3, (rac)-N,O-Didesmethyl Tramadol-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg.
3-[(1R,2R)-1-hydroxy-2-[(trideuteriomethylamino)methyl]cyclohexyl]phenol (CAS 1261398-22-4) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 238.34 g/mol. IUPAC name: 3-[(1R,2R)-1-hydroxy-2-[(trideuteriomethylamino)methyl]cyclohexyl]phenol. InChIKey: CJXNQQLTDXASSR-NTYUZJTFSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 238.34 g/mol |
| IUPAC name | 3-[(1R,2R)-1-hydroxy-2-[(trideuteriomethylamino)methyl]cyclohexyl]phenol |
| InChIKey | CJXNQQLTDXASSR-NTYUZJTFSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)O)O |
Computed by PubChem (NCBI)