CAS 1261432-00-1 appears in our catalog under these names: Axitinib–13C–d3, Axitinib-13C-d3, Axitinib-13C-d3, 97%, 97%, Axitinib-13C,d3, 97.80%. Offered by: GLPBio, Chemat Brand, Chemat, MedChemExpress. Available pack sizes: 1mg, on request, 500μg, 5 mg, 1 mg, 10 mg.
2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]-N-(trideuterio(113C)methyl)benzamide (CAS 1261432-00-1) is a chemical compound with the molecular formula C22H18N4OS and a molecular weight of 390.5 g/mol. IUPAC name: 2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]-N-(trideuterio(113C)methyl)benzamide. InChIKey: RITAVMQDGBJQJZ-QUYHSVBSSA-N.
| Molecular formula | C22H18N4OS |
|---|---|
| Molecular weight | 390.5 g/mol |
| IUPAC name | 2-[[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]sulfanyl]-N-(trideuterio(113C)methyl)benzamide |
| InChIKey | RITAVMQDGBJQJZ-QUYHSVBSSA-N |
| SMILES | [2H][13C]([2H])([2H])NC(=O)C1=CC=CC=C1SC2=CC3=C(C=C2)C(=NN3)/C=C/C4=CC=CC=N4 |
Computed by PubChem (NCBI)