CAS 2567913-75-9 is the registry number for MG-1102. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[1-[[5-(6-methoxynaphthalen-2-yl)-1H-pyrazol-4-yl]methyl]pyrrol-2-yl]-1,3-thiazole (CAS 2567913-75-9) is a chemical compound with the molecular formula C22H18N4OS and a molecular weight of 386.5 g/mol. IUPAC name: 2-[1-[[5-(6-methoxynaphthalen-2-yl)-1H-pyrazol-4-yl]methyl]pyrrol-2-yl]-1,3-thiazole. InChIKey: JLWKAIUMWRZNJT-UHFFFAOYSA-N.
| Molecular formula | C22H18N4OS |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 2-[1-[[5-(6-methoxynaphthalen-2-yl)-1H-pyrazol-4-yl]methyl]pyrrol-2-yl]-1,3-thiazole |
| InChIKey | JLWKAIUMWRZNJT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C3=C(C=NN3)CN4C=CC=C4C5=NC=CS5 |
Computed by PubChem (NCBI)