CAS 1261433-31-1 appears in our catalog under these names: 7-Fluoroisoindolin-1-one, 98%, 7-Fluoroisoindolin-1-one 98%, 7-Fluoroisoindolin-1-one, 98%, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 50mg, 500mg.
7-fluoro-2,3-dihydroisoindol-1-one (CAS 1261433-31-1) is a chemical compound with the molecular formula C8H6FNO and a molecular weight of 151.14 g/mol. IUPAC name: 7-fluoro-2,3-dihydroisoindol-1-one. InChIKey: ZZTUZMIZZLVYHG-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO |
|---|---|
| Molecular weight | 151.14 g/mol |
| IUPAC name | 7-fluoro-2,3-dihydroisoindol-1-one |
| InChIKey | ZZTUZMIZZLVYHG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)F)C(=O)N1 |
Computed by PubChem (NCBI)