CAS 1261442-19-6 appears in our catalog under these names: 2-(Difluoromethyl)-6-fluorobenzonitrile, 2-(Difluoromethyl)-6-fluorobenzonitrile, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 250mg, 1g.
2-(difluoromethyl)-6-fluorobenzonitrile (CAS 1261442-19-6) is a chemical compound with the molecular formula C8H4F3N and a molecular weight of 171.12 g/mol. IUPAC name: 2-(difluoromethyl)-6-fluorobenzonitrile. InChIKey: WLKHYBNMZWIWGN-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N |
|---|---|
| Molecular weight | 171.12 g/mol |
| IUPAC name | 2-(difluoromethyl)-6-fluorobenzonitrile |
| InChIKey | WLKHYBNMZWIWGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C#N)C(F)F |
Computed by PubChem (NCBI)