CAS 247564-64-3 appears in our catalog under these names: 5,6,7-Trifluoro-1h-indole, 95%, 5,6,7-Trifluoro-1H-indole, 5,6,7-Trifluoro-1H-indole, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 50mg, 0,5g, 100mg, 500mg.
5,6,7-trifluoro-1H-indole (CAS 247564-64-3) is a chemical compound with the molecular formula C8H4F3N and a molecular weight of 171.12 g/mol. IUPAC name: 5,6,7-trifluoro-1H-indole. InChIKey: QSMSVCBDSJEBFM-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N |
|---|---|
| Molecular weight | 171.12 g/mol |
| IUPAC name | 5,6,7-trifluoro-1H-indole |
| InChIKey | QSMSVCBDSJEBFM-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C(=C(C=C21)F)F)F |
Computed by PubChem (NCBI)