CAS 1261470-50-1 is the registry number for 2-(8-Iodonaphthalen-1-yl)acetonitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(8-iodonaphthalen-1-yl)acetonitrile (CAS 1261470-50-1) is a chemical compound with the molecular formula C12H8IN and a molecular weight of 293.10 g/mol. IUPAC name: 2-(8-iodonaphthalen-1-yl)acetonitrile. InChIKey: GSFHCHFUGUBHJT-UHFFFAOYSA-N.
| Molecular formula | C12H8IN |
|---|---|
| Molecular weight | 293.10 g/mol |
| IUPAC name | 2-(8-iodonaphthalen-1-yl)acetonitrile |
| InChIKey | GSFHCHFUGUBHJT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CC#N)C(=CC=C2)I |
Computed by PubChem (NCBI)