CAS 16807-13-9 appears in our catalog under these names: 3–Iodocarbazole, 3-Iodocarbazole, >98.0%(GC), 3-Iodo-9H-carbazole 98%, 3-Iodo-9H-carbazole, 98%, 98%, 3-Iodo-9H-carbazole, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 500g, 1g.
3-iodo-9H-carbazole (CAS 16807-13-9) is a chemical compound with the molecular formula C12H8IN and a molecular weight of 293.10 g/mol. IUPAC name: 3-iodo-9H-carbazole. InChIKey: OYIGWMXXIFYAGD-UHFFFAOYSA-N.
| Molecular formula | C12H8IN |
|---|---|
| Molecular weight | 293.10 g/mol |
| IUPAC name | 3-iodo-9H-carbazole |
| InChIKey | OYIGWMXXIFYAGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)I |
Computed by PubChem (NCBI)