CAS 1261503-00-7 is the registry number for 4'–(Trifluoromethoxy)–5–(trifluoromethyl)–(1,1'–biphenyl)–3–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)benzoic acid (CAS 1261503-00-7) is a chemical compound with the molecular formula C15H8F6O3 and a molecular weight of 350.21 g/mol. IUPAC name: 3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)benzoic acid. InChIKey: CVCGIORMQQAACT-UHFFFAOYSA-N.
| Molecular formula | C15H8F6O3 |
|---|---|
| Molecular weight | 350.21 g/mol |
| IUPAC name | 3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)benzoic acid |
| InChIKey | CVCGIORMQQAACT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(F)(F)F)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)