Products 762286-35-1

CAS 762286-35-1 is the registry number for 4-[3,5-Bis(trifluoromethyl)phenoxy]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-[3,5-bis(trifluoromethyl)phenoxy]benzoic acid (CAS 762286-35-1) is a chemical compound with the molecular formula C15H8F6O3 and a molecular weight of 350.21 g/mol. IUPAC name: 4-[3,5-bis(trifluoromethyl)phenoxy]benzoic acid. InChIKey: WJKKJJXROCHBMA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H8F6O3
Molecular weight350.21 g/mol
IUPAC name4-[3,5-bis(trifluoromethyl)phenoxy]benzoic acid
InChIKeyWJKKJJXROCHBMA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F

Computed by PubChem (NCBI)