CAS 762286-35-1 is the registry number for 4-[3,5-Bis(trifluoromethyl)phenoxy]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-[3,5-bis(trifluoromethyl)phenoxy]benzoic acid (CAS 762286-35-1) is a chemical compound with the molecular formula C15H8F6O3 and a molecular weight of 350.21 g/mol. IUPAC name: 4-[3,5-bis(trifluoromethyl)phenoxy]benzoic acid. InChIKey: WJKKJJXROCHBMA-UHFFFAOYSA-N.
| Molecular formula | C15H8F6O3 |
|---|---|
| Molecular weight | 350.21 g/mol |
| IUPAC name | 4-[3,5-bis(trifluoromethyl)phenoxy]benzoic acid |
| InChIKey | WJKKJJXROCHBMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)