CAS 1261577-22-3 is the registry number for 5-hydroxyquinoline-3-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
5-hydroxyquinoline-3-carbonitrile (CAS 1261577-22-3) is a chemical compound with the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. IUPAC name: 5-hydroxyquinoline-3-carbonitrile. InChIKey: OFWJAZNSMSFYCE-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 5-hydroxyquinoline-3-carbonitrile |
| InChIKey | OFWJAZNSMSFYCE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)C#N)C(=C1)O |
Computed by PubChem (NCBI)