Products 1261584-19-3

CAS 1261584-19-3 appears in our catalog under these names: 5-Bromo-2-methoxy-3-pyridinesulfonyl Chloride, 5-Bromo-2-methoxypyridine-3-sulfonyl chloride 95%, 5-Bromo-2-methoxypyridine-3-sulfonyl chloride, 97%, 5-Bromo-2-methoxypyridine-3-sulfonyl chloride, 97%, 97%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.

Structural formula: {0} (CAS {1})

5-bromo-2-methoxypyridine-3-sulfonyl chloride (CAS 1261584-19-3) is a chemical compound with the molecular formula C6H5BrClNO3S and a molecular weight of 286.53 g/mol. IUPAC name: 5-bromo-2-methoxypyridine-3-sulfonyl chloride. InChIKey: HPGXYLFNEUZNHH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrClNO3S
Molecular weight286.53 g/mol
IUPAC name5-bromo-2-methoxypyridine-3-sulfonyl chloride
InChIKeyHPGXYLFNEUZNHH-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=N1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)