CAS 1261858-64-3 appears in our catalog under these names: 5-Bromo-6-methoxypyridine-3-sulfonyl chloride, 96%, 5-Bromo-6-methoxy-3-pyridinesulfonyl chloride, 96%, 96%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
5-bromo-6-methoxypyridine-3-sulfonyl chloride (CAS 1261858-64-3) is a chemical compound with the molecular formula C6H5BrClNO3S and a molecular weight of 286.53 g/mol. IUPAC name: 5-bromo-6-methoxypyridine-3-sulfonyl chloride. InChIKey: XLFSGBXMEOQXGV-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClNO3S |
|---|---|
| Molecular weight | 286.53 g/mol |
| IUPAC name | 5-bromo-6-methoxypyridine-3-sulfonyl chloride |
| InChIKey | XLFSGBXMEOQXGV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)