Products 1261587-75-0

CAS 1261587-75-0 is the registry number for 3-[4-Methoxy-3-(trifluoromethoxy)phenyl]propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[4-methoxy-3-(trifluoromethoxy)phenyl]propanoic acid (CAS 1261587-75-0) is a chemical compound with the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. IUPAC name: 3-[4-methoxy-3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: DALLMZMEZXJMBE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F3O4
Molecular weight264.20 g/mol
IUPAC name3-[4-methoxy-3-(trifluoromethoxy)phenyl]propanoic acid
InChIKeyDALLMZMEZXJMBE-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CCC(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)