Products 2301067-52-5

CAS 2301067-52-5 is the registry number for [4-Methoxy-3-(2,2,2-trifluoro-ethoxy)-phenyl]-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]acetic acid (CAS 2301067-52-5) is a chemical compound with the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. IUPAC name: 2-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]acetic acid. InChIKey: UUNSYACBSVEXQN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F3O4
Molecular weight264.20 g/mol
IUPAC name2-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]acetic acid
InChIKeyUUNSYACBSVEXQN-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CC(=O)O)OCC(F)(F)F

Computed by PubChem (NCBI)