CAS 1261606-45-4 is the registry number for 4-Bromo-2-chlorobenzeneacetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Ethyl 2-(4-bromo-2-chlorophenyl)acetate (CAS 1261606-45-4) is a chemical compound with the molecular formula C10H10BrClO2 and a molecular weight of 277.54 g/mol. IUPAC name: ethyl 2-(4-bromo-2-chlorophenyl)acetate. InChIKey: OVTWAXDDSNTWCB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO2 |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | ethyl 2-(4-bromo-2-chlorophenyl)acetate |
| InChIKey | OVTWAXDDSNTWCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)