CAS 1261629-26-8 appears in our catalog under these names: 2-Chloro-7-(difluoromethoxy)benzo(d)thiazole, 97%, 2-Chloro-7-(difluoromethoxy)-1,3-benzothiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-7-(difluoromethoxy)-1,3-benzothiazole (CAS 1261629-26-8) is a chemical compound with the molecular formula C8H4ClF2NOS and a molecular weight of 235.64 g/mol. IUPAC name: 2-chloro-7-(difluoromethoxy)-1,3-benzothiazole. InChIKey: WUXHUZJAPXOFBN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2NOS |
|---|---|
| Molecular weight | 235.64 g/mol |
| IUPAC name | 2-chloro-7-(difluoromethoxy)-1,3-benzothiazole |
| InChIKey | WUXHUZJAPXOFBN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OC(F)F)SC(=N2)Cl |
Computed by PubChem (NCBI)