CAS 1261786-73-5 appears in our catalog under these names: 2-Chloro-6-(difluoromethoxy)benzo[d]thiazole, 95%, 2–Chloro–6–(difluoromethoxy)benzo(d)thiazole. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
2-chloro-6-(difluoromethoxy)-1,3-benzothiazole (CAS 1261786-73-5) is a chemical compound with the molecular formula C8H4ClF2NOS and a molecular weight of 235.64 g/mol. IUPAC name: 2-chloro-6-(difluoromethoxy)-1,3-benzothiazole. InChIKey: XTZJIDNYUNWXMN-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF2NOS |
|---|---|
| Molecular weight | 235.64 g/mol |
| IUPAC name | 2-chloro-6-(difluoromethoxy)-1,3-benzothiazole |
| InChIKey | XTZJIDNYUNWXMN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)F)SC(=N2)Cl |
Computed by PubChem (NCBI)