CAS 1261643-06-4 appears in our catalog under these names: 2'-Bromo-4'-methylpropiophenone, 95%, 1-(2-Bromo-4-methylphenyl)propan-1-one, 98%, 1-Propanone, 1-(2-bromo-4-methylphenyl)-, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 100g, 25g, 1g, 250mg.
1-(2-bromo-4-methylphenyl)propan-1-one (CAS 1261643-06-4) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 1-(2-bromo-4-methylphenyl)propan-1-one. InChIKey: ZCQPLHJQGPEELZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 1-(2-bromo-4-methylphenyl)propan-1-one |
| InChIKey | ZCQPLHJQGPEELZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)C)Br |
Computed by PubChem (NCBI)