CAS 1261743-98-9 is the registry number for 4-Fluoro-2'-(trifluoromethoxy)biphenyl-3-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoate (CAS 1261743-98-9) is a chemical compound with the molecular formula C15H10F4O3 and a molecular weight of 314.23 g/mol. IUPAC name: methyl 2-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoate. InChIKey: AWDOWCJGVLLHDI-UHFFFAOYSA-N.
| Molecular formula | C15H10F4O3 |
|---|---|
| Molecular weight | 314.23 g/mol |
| IUPAC name | methyl 2-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoate |
| InChIKey | AWDOWCJGVLLHDI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C2=CC=CC=C2OC(F)(F)F)F |
Computed by PubChem (NCBI)