CAS 2379321-87-4 appears in our catalog under these names: 3-(Benzyloxy)-2-fluoro-5-(trifluoromethyl)benzoic acid, 95%, 3-(Benzyloxy)-2-fluoro-5-(trifluoromethyl)benzoic acid, 98%, 3-(Benzyloxy)-2-fluoro-5-(trifluoromethyl)benzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-fluoro-3-phenylmethoxy-5-(trifluoromethyl)benzoic acid (CAS 2379321-87-4) is a chemical compound with the molecular formula C15H10F4O3 and a molecular weight of 314.23 g/mol. IUPAC name: 2-fluoro-3-phenylmethoxy-5-(trifluoromethyl)benzoic acid. InChIKey: MKSWFLFEHWVHHX-UHFFFAOYSA-N.
| Molecular formula | C15H10F4O3 |
|---|---|
| Molecular weight | 314.23 g/mol |
| IUPAC name | 2-fluoro-3-phenylmethoxy-5-(trifluoromethyl)benzoic acid |
| InChIKey | MKSWFLFEHWVHHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2F)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)