Products 1261767-10-5
CAS 1261767-10-5 appears in our catalog under these names: 3-(trifluoromethyl)-1,4-dihydroquinolin-4-one, 98%, 3-(Trifluoromethyl)quinolin-4-ol, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(trifluoromethyl)-1H-quinolin-4-one (CAS 1261767-10-5) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: 3-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: SAFHXQJHAGCBFO-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | SAFHXQJHAGCBFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=CN2)C(F)(F)F |
Computed by PubChem (NCBI)