Products 1261783-55-4

CAS 1261783-55-4 appears in our catalog under these names: 5-Fluoro-6-methoxypyridine-2-sulfonyl chloride, 95%, 5-Fluoro-6-methoxypyridine-2-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-fluoro-6-methoxypyridine-2-sulfonyl chloride (CAS 1261783-55-4) is a chemical compound with the molecular formula C6H5ClFNO3S and a molecular weight of 225.63 g/mol. IUPAC name: 5-fluoro-6-methoxypyridine-2-sulfonyl chloride. InChIKey: VWGCDXJVNGSTJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClFNO3S
Molecular weight225.63 g/mol
IUPAC name5-fluoro-6-methoxypyridine-2-sulfonyl chloride
InChIKeyVWGCDXJVNGSTJZ-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=N1)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)