Products 1261870-77-2

CAS 1261870-77-2 is the registry number for 3-Fluoro-5-methoxypyridine-2-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-fluoro-5-methoxypyridine-2-sulfonyl chloride (CAS 1261870-77-2) is a chemical compound with the molecular formula C6H5ClFNO3S and a molecular weight of 225.63 g/mol. IUPAC name: 3-fluoro-5-methoxypyridine-2-sulfonyl chloride. InChIKey: QUSOIDYSJOZKIT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClFNO3S
Molecular weight225.63 g/mol
IUPAC name3-fluoro-5-methoxypyridine-2-sulfonyl chloride
InChIKeyQUSOIDYSJOZKIT-UHFFFAOYSA-N
SMILESCOC1=CC(=C(N=C1)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)