CAS 1261791-50-7 is the registry number for Ethyl 3-bromo-2-chlorobenzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 3-bromo-2-chlorobenzoate (CAS 1261791-50-7) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: ethyl 3-bromo-2-chlorobenzoate. InChIKey: FDVSBPVGYUMGND-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | ethyl 3-bromo-2-chlorobenzoate |
| InChIKey | FDVSBPVGYUMGND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)Br)Cl |
Computed by PubChem (NCBI)