Products 1261791-50-7

CAS 1261791-50-7 is the registry number for Ethyl 3-bromo-2-chlorobenzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 3-bromo-2-chlorobenzoate (CAS 1261791-50-7) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: ethyl 3-bromo-2-chlorobenzoate. InChIKey: FDVSBPVGYUMGND-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrClO2
Molecular weight263.51 g/mol
IUPAC nameethyl 3-bromo-2-chlorobenzoate
InChIKeyFDVSBPVGYUMGND-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=CC=C1)Br)Cl

Computed by PubChem (NCBI)