CAS 1261792-29-3 appears in our catalog under these names: 2-Bromo-1-(4-bromo-2-iodophenyl)ethan-1-one, 95%, 2-Bromo-1-(4-bromo-2-iodophenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-bromo-1-(4-bromo-2-iodophenyl)ethanone (CAS 1261792-29-3) is a chemical compound with the molecular formula C8H5Br2IO and a molecular weight of 403.84 g/mol. IUPAC name: 2-bromo-1-(4-bromo-2-iodophenyl)ethanone. InChIKey: SRPONCQRGKBLPF-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2IO |
|---|---|
| Molecular weight | 403.84 g/mol |
| IUPAC name | 2-bromo-1-(4-bromo-2-iodophenyl)ethanone |
| InChIKey | SRPONCQRGKBLPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)I)C(=O)CBr |
Computed by PubChem (NCBI)