CAS 2259295-22-0 is the registry number for 2,2-Dibromo-1-(2-iodophenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dibromo-1-(2-iodophenyl)ethanone (CAS 2259295-22-0) is a chemical compound with the molecular formula C8H5Br2IO and a molecular weight of 403.84 g/mol. IUPAC name: 2,2-dibromo-1-(2-iodophenyl)ethanone. InChIKey: HEYMOQISGMXVJR-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2IO |
|---|---|
| Molecular weight | 403.84 g/mol |
| IUPAC name | 2,2-dibromo-1-(2-iodophenyl)ethanone |
| InChIKey | HEYMOQISGMXVJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(Br)Br)I |
Computed by PubChem (NCBI)