CAS 1261806-38-5 appears in our catalog under these names: 3-Amino-2-fluoro-2'-(trifluoromethyl)biphenyl, 95%, 3-Amino-2-fluoro-2'-(trifluoromethyl)biphenyl. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-fluoro-3-[2-(trifluoromethyl)phenyl]aniline (CAS 1261806-38-5) is a chemical compound with the molecular formula C13H9F4N and a molecular weight of 255.21 g/mol. IUPAC name: 2-fluoro-3-[2-(trifluoromethyl)phenyl]aniline. InChIKey: GXAZZZFMHRSMAS-UHFFFAOYSA-N.
| Molecular formula | C13H9F4N |
|---|---|
| Molecular weight | 255.21 g/mol |
| IUPAC name | 2-fluoro-3-[2-(trifluoromethyl)phenyl]aniline |
| InChIKey | GXAZZZFMHRSMAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=CC=C2)N)F)C(F)(F)F |
Computed by PubChem (NCBI)